C7H11NO3 — CID 89038514
(3Z,5E)-6-aminohepta-1,3,5-triene-2,3,4-triol (PubChem CID 89038514) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is (3Z,5E)-6-aminohepta-1,3,5-triene-2,3,4-triol.
| Compound Name | (3Z,5E)-6-aminohepta-1,3,5-triene-2,3,4-triol |
|---|---|
| PubChem CID | 89038514 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | (3Z,5E)-6-aminohepta-1,3,5-triene-2,3,4-triol |
| SMILES | C=C(O)/C(O)=C(O)\C=C(/C)N |
| InChI | InChI=1S/C7H11NO3/c1-4(8)3-6(10)7(11)5(2)9/h3,9-11H,2,8H2,1H3/b4-3+,7-6- |
| InChIKey | VCAPGZMFUJOGBM-FDTUMDBZSA-N |
| XLogP | 1.25 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|