C21H29N3O2 — CID 129168583
[1-[(2E,3Z)-5-[(3S)-2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-3-yl]-2-ethylidenehexa-3,5-dienyl]piperidin-4-yl]methanamine (PubChem CID 129168583) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is [1-[(2E,3Z)-5-[(3S)-2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-3-yl]-2-ethylidenehexa-3,5-dienyl]piperidin-4-yl]methanamine.
| Compound Name | [1-[(2E,3Z)-5-[(3S)-2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-3-yl]-2-ethylidenehexa-3,5-dienyl]piperidin-4-yl]methanamine |
|---|---|
| PubChem CID | 129168583 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | [1-[(2E,3Z)-5-[(3S)-2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-3-yl]-2-ethylidenehexa-3,5-dienyl]piperidin-4-yl]methanamine |
| SMILES | C=C(/C=C\C(=C/C)CN1CCC(CN)CC1)[C@H]1COc2cccnc2O1 |
| InChI | InChI=1S/C21H29N3O2/c1-3-17(14-24-11-8-18(13-22)9-12-24)7-6-16(2)20-15-25-19-5-4-10-23-21(19)26-20/h3-7,10,18,20H,2,8-9,11-15,22H2,1H3/b7-6-,17-3+/t20-/m1/s1 |
| InChIKey | GYFJFFJKKDDJBU-XQMYNRJYSA-N |
| XLogP | 2.95 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|