C12H10ClF3N2 — CID 129168780
5-[2-[2-chloro-4-(trifluoromethyl)phenyl]ethyl]-1H-pyrazole (PubChem CID 129168780) has the molecular formula C12H10ClF3N2 and a molecular weight of 274.67 g/mol. Its IUPAC name is 5-[2-[2-chloro-4-(trifluoromethyl)phenyl]ethyl]-1H-pyrazole.
| Compound Name | 5-[2-[2-chloro-4-(trifluoromethyl)phenyl]ethyl]-1H-pyrazole |
|---|---|
| PubChem CID | 129168780 |
| Molecular Formula | C12H10ClF3N2 |
| Molecular Weight | 274.67 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 5-[2-[2-chloro-4-(trifluoromethyl)phenyl]ethyl]-1H-pyrazole |
| SMILES | FC(F)(F)c1ccc(CCc2ccn[nH]2)c(Cl)c1 |
| InChI | InChI=1S/C12H10ClF3N2/c13-11-7-9(12(14,15)16)3-1-8(11)2-4-10-5-6-17-18-10/h1,3,5-7H,2,4H2,(H,17,18) |
| InChIKey | KKHDRCIDMFEISC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.67 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |