C8H9FN2 — CID 129170407
(3E,5E)-3-amino-5-fluoro-2-methylidenehepta-3,5-dienenitrile (PubChem CID 129170407) has the molecular formula C8H9FN2 and a molecular weight of 152.17 g/mol. Its IUPAC name is (3E,5E)-3-amino-5-fluoro-2-methylidenehepta-3,5-dienenitrile.
| Compound Name | (3E,5E)-3-amino-5-fluoro-2-methylidenehepta-3,5-dienenitrile |
|---|---|
| PubChem CID | 129170407 |
| Molecular Formula | C8H9FN2 |
| Molecular Weight | 152.17 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | (3E,5E)-3-amino-5-fluoro-2-methylidenehepta-3,5-dienenitrile |
| SMILES | C=C(C#N)/C(N)=C\C(F)=C/C |
| InChI | InChI=1S/C8H9FN2/c1-3-7(9)4-8(11)6(2)5-10/h3-4H,2,11H2,1H3/b7-3+,8-4+ |
| InChIKey | FYUVKSPWBNGOTK-FCXRPNKRSA-N |
| XLogP | 1.78 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.17 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|