C8H11FN2 — CID 89148270
(E,2Z)-2-(1-aminoethylidene)-4-fluorohex-3-enenitrile (PubChem CID 89148270) has the molecular formula C8H11FN2 and a molecular weight of 154.19 g/mol. Its IUPAC name is (E,2Z)-2-(1-aminoethylidene)-4-fluorohex-3-enenitrile.
| Compound Name | (E,2Z)-2-(1-aminoethylidene)-4-fluorohex-3-enenitrile |
|---|---|
| PubChem CID | 89148270 |
| Molecular Formula | C8H11FN2 |
| Molecular Weight | 154.19 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | (E,2Z)-2-(1-aminoethylidene)-4-fluorohex-3-enenitrile |
| SMILES | CC/C(F)=C\C(C#N)=C(/C)N |
| InChI | InChI=1S/C8H11FN2/c1-3-8(9)4-7(5-10)6(2)11/h4H,3,11H2,1-2H3/b7-6-,8-4+ |
| InChIKey | BQSWMENSDXCOOE-AKAREZBESA-N |
| XLogP | 2.01 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.19 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|