C10H13F3N2 — CID 146329172
(2Z,4E)-5-amino-2-propan-2-yl-3-(trifluoromethyl)hexa-2,4-dienenitrile (PubChem CID 146329172) has the molecular formula C10H13F3N2 and a molecular weight of 218.22 g/mol. Its IUPAC name is (2Z,4E)-5-amino-2-propan-2-yl-3-(trifluoromethyl)hexa-2,4-dienenitrile.
| Compound Name | (2Z,4E)-5-amino-2-propan-2-yl-3-(trifluoromethyl)hexa-2,4-dienenitrile |
|---|---|
| PubChem CID | 146329172 |
| Molecular Formula | C10H13F3N2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | (2Z,4E)-5-amino-2-propan-2-yl-3-(trifluoromethyl)hexa-2,4-dienenitrile |
| SMILES | C/C(N)=C\C(=C(\C#N)C(C)C)C(F)(F)F |
| InChI | InChI=1S/C10H13F3N2/c1-6(2)8(5-14)9(4-7(3)15)10(11,12)13/h4,6H,15H2,1-3H3/b7-4+,9-8+ |
| InChIKey | JBLXQBDKCXMGIF-NUXDXBQRSA-N |
| XLogP | 2.89 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|