C12H25NO4P+ — CID 129171086
2-[1-(2-prop-2-enoxyethyl)piperidin-1-ium-1-yl]ethyl dihydrogen phosphite (PubChem CID 129171086) has the molecular formula C12H25NO4P+ and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-[1-(2-prop-2-enoxyethyl)piperidin-1-ium-1-yl]ethyl dihydrogen phosphite.
| Compound Name | 2-[1-(2-prop-2-enoxyethyl)piperidin-1-ium-1-yl]ethyl dihydrogen phosphite |
|---|---|
| PubChem CID | 129171086 |
| Molecular Formula | C12H25NO4P+ |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 2-[1-(2-prop-2-enoxyethyl)piperidin-1-ium-1-yl]ethyl dihydrogen phosphite |
| SMILES | C=CCOCC[N+]1(CCOP(O)O)CCCCC1 |
| InChI | InChI=1S/C12H25NO4P/c1-2-10-16-11-8-13(6-4-3-5-7-13)9-12-17-18(14)15/h2,14-15H,1,3-12H2/q+1 |
| InChIKey | CBBSMBYPLSEFCX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|