C23H36NO8+ — CID 162768230
[2-[2-[1-(2-methoxyethyl)pyrrolidin-1-ium-1-yl]ethoxymethyl]-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate (PubChem CID 162768230) has the molecular formula C23H36NO8+ and a molecular weight of 454.54 g/mol. Its IUPAC name is [2-[2-[1-(2-methoxyethyl)pyrrolidin-1-ium-1-yl]ethoxymethyl]-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate.
| Compound Name | [2-[2-[1-(2-methoxyethyl)pyrrolidin-1-ium-1-yl]ethoxymethyl]-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate |
|---|---|
| PubChem CID | 162768230 |
| Molecular Formula | C23H36NO8+ |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | [2-[2-[1-(2-methoxyethyl)pyrrolidin-1-ium-1-yl]ethoxymethyl]-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(COCC[N+]1(CCOC)CCCC1)(COC(=O)C=C)COC(=O)C=C |
| InChI | InChI=1S/C23H36NO8/c1-5-20(25)30-17-23(18-31-21(26)6-2,19-32-22(27)7-3)16-29-15-13-24(12-14-28-4)10-8-9-11-24/h5-7H,1-3,8-19H2,4H3/q+1 |
| InChIKey | GPTHROPJJXZYFR-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|