C9H16N3O2S- — CID 129173767
1,5-dimethyl-3-(2-methylpropyl)-4-(sulfinatoamino)pyrazole (PubChem CID 129173767) has the molecular formula C9H16N3O2S- and a molecular weight of 230.31 g/mol. Its IUPAC name is 1,5-dimethyl-3-(2-methylpropyl)-4-(sulfinatoamino)pyrazole.
| Compound Name | 1,5-dimethyl-3-(2-methylpropyl)-4-(sulfinatoamino)pyrazole |
|---|---|
| PubChem CID | 129173767 |
| Molecular Formula | C9H16N3O2S- |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | 1,5-dimethyl-3-(2-methylpropyl)-4-(sulfinatoamino)pyrazole |
| SMILES | Cc1c(NS(=O)[O-])c(CC(C)C)nn1C |
| InChI | InChI=1S/C9H17N3O2S/c1-6(2)5-8-9(11-15(13)14)7(3)12(4)10-8/h6,11H,5H2,1-4H3,(H,13,14)/p-1 |
| InChIKey | FSTMQWMKYLODBX-UHFFFAOYSA-M |
| XLogP | 1.13 |
| TPSA | 69.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|