C40H30N2 — CID 129176388
N-[(E)-2-[4-(13-azapentacyclo[12.8.0.02,11.03,8.015,20]docosa-1,3,5,7,9,11,13,15,17,19,21-undecaen-12-yl)-2-methyl-3-[(Z)-prop-1-enyl]naphthalen-1-yl]ethenyl]prop-2-en-1-imine (PubChem CID 129176388) has the molecular formula C40H30N2 and a molecular weight of 538.69 g/mol. Its IUPAC name is N-[(E)-2-[4-(13-azapentacyclo[12.8.0.02,11.03,8.015,20]docosa-1,3,5,7,9,11,13,15,17,19,21-undecaen-12-yl)-2-methyl-3-[(Z)-prop-1-enyl]naphthalen-1-yl]ethenyl]prop-2-en-1-imine.
| Compound Name | N-[(E)-2-[4-(13-azapentacyclo[12.8.0.02,11.03,8.015,20]docosa-1,3,5,7,9,11,13,15,17,19,21-undecaen-12-yl)-2-methyl-3-[(Z)-prop-1-enyl]naphthalen-1-yl]ethenyl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 129176388 |
| Molecular Formula | C40H30N2 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | N-[(E)-2-[4-(13-azapentacyclo[12.8.0.02,11.03,8.015,20]docosa-1,3,5,7,9,11,13,15,17,19,21-undecaen-12-yl)-2-methyl-3-[(Z)-prop-1-enyl]naphthalen-1-yl]ethenyl]prop-2-en-1-imine |
| SMILES | C=C/C=N/C=C/c1c(C)c(/C=C\C)c(-c2nc3c4ccccc4ccc3c3c2ccc2ccccc23)c2ccccc12 |
| InChI | InChI=1S/C40H30N2/c1-4-12-30-26(3)29(23-25-41-24-5-2)33-17-10-11-18-34(33)38(30)40-36-22-19-27-13-6-8-15-31(27)37(36)35-21-20-28-14-7-9-16-32(28)39(35)42-40/h4-25H,2H2,1,3H3/b12-4-,25-23+,41-24+ |
| InChIKey | WRZMJKOKLQVJIH-QRJVPOACSA-N |
| XLogP | 11.08 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|