C25H21F2N7O — CID 129181243
[2-[5-(4-fluorophenyl)pyrimidin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-fluoro-6-(triazol-2-yl)phenyl]methanone (PubChem CID 129181243) has the molecular formula C25H21F2N7O and a molecular weight of 473.49 g/mol. Its IUPAC name is [2-[5-(4-fluorophenyl)pyrimidin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-fluoro-6-(triazol-2-yl)phenyl]methanone.
| Compound Name | [2-[5-(4-fluorophenyl)pyrimidin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-fluoro-6-(triazol-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 129181243 |
| Molecular Formula | C25H21F2N7O |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | [2-[5-(4-fluorophenyl)pyrimidin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-fluoro-6-(triazol-2-yl)phenyl]methanone |
| SMILES | O=C(c1c(F)cccc1-n1nccn1)N1CC2CN(c3ncc(-c4ccc(F)cc4)cn3)CC2C1 |
| InChI | InChI=1S/C25H21F2N7O/c26-20-6-4-16(5-7-20)17-10-28-25(29-11-17)33-14-18-12-32(13-19(18)15-33)24(35)23-21(27)2-1-3-22(23)34-30-8-9-31-34/h1-11,18-19H,12-15H2 |
| InChIKey | JVCNTKHYQBZMKI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 80.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |