C22H20FN7O2 — CID 168869608
[(3aR,6aS)-2-(4-methylfuro[2,3-d]pyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-fluoro-6-(triazol-2-yl)phenyl]methanone (PubChem CID 168869608) has the molecular formula C22H20FN7O2 and a molecular weight of 433.45 g/mol. Its IUPAC name is [(3aR,6aS)-2-(4-methylfuro[2,3-d]pyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-fluoro-6-(triazol-2-yl)phenyl]methanone.
| Compound Name | [(3aR,6aS)-2-(4-methylfuro[2,3-d]pyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-fluoro-6-(triazol-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 168869608 |
| Molecular Formula | C22H20FN7O2 |
| Molecular Weight | 433.45 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | [(3aR,6aS)-2-(4-methylfuro[2,3-d]pyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-fluoro-6-(triazol-2-yl)phenyl]methanone |
| SMILES | Cc1nc(N2C[C@H]3CN(C(=O)c4c(F)cccc4-n4nccn4)C[C@H]3C2)nc2occc12 |
| InChI | InChI=1S/C22H20FN7O2/c1-13-16-5-8-32-20(16)27-22(26-13)29-11-14-9-28(10-15(14)12-29)21(31)19-17(23)3-2-4-18(19)30-24-6-7-25-30/h2-8,14-15H,9-12H2,1H3/t14-,15+ |
| InChIKey | LYYXYGDVLHNPSV-GASCZTMLSA-N |
| XLogP | 2.46 |
| TPSA | 93.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |