C21H24FN7O — CID 158602053
2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-[2-fluoro-6-(triazol-2-yl)phenyl]methanone;4,6-dimethyl(213C,1,3-15N2)pyrimidine (PubChem CID 158602053) has the molecular formula C21H24FN7O and a molecular weight of 412.45 g/mol. Its IUPAC name is 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-[2-fluoro-6-(triazol-2-yl)phenyl]methanone;4,6-dimethyl(213C,1,3-15N2)pyrimidine.
| Compound Name | 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-[2-fluoro-6-(triazol-2-yl)phenyl]methanone;4,6-dimethyl(213C,1,3-15N2)pyrimidine |
|---|---|
| PubChem CID | 158602053 |
| Molecular Formula | C21H24FN7O |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-[2-fluoro-6-(triazol-2-yl)phenyl]methanone;4,6-dimethyl(213C,1,3-15N2)pyrimidine |
| SMILES | Cc1cc(C)[15n][13cH][15n]1.O=C(c1c(F)cccc1-n1nccn1)N1CC2CNCC2C1 |
| InChI | InChI=1S/C15H16FN5O.C6H8N2/c16-12-2-1-3-13(21-18-4-5-19-21)14(12)15(22)20-8-10-6-17-7-11(10)9-20;1-5-3-6(2)8-4-7-5/h1-5,10-11,17H,6-9H2;3-4H,1-2H3/i;4+1,7+1,8+1 |
| InChIKey | HVTHLPQAQQODFX-PRFBJQMVSA-N |
| XLogP | 1.79 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |