C15H21BrN2O6 — CID 129187208
6-[(3-bromo-2,5-dioxopyrrol-1-yl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexanoic acid (PubChem CID 129187208) has the molecular formula C15H21BrN2O6 and a molecular weight of 405.25 g/mol. Its IUPAC name is 6-[(3-bromo-2,5-dioxopyrrol-1-yl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexanoic acid.
| Compound Name | 6-[(3-bromo-2,5-dioxopyrrol-1-yl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 129187208 |
| Molecular Formula | C15H21BrN2O6 |
| Molecular Weight | 405.25 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 6-[(3-bromo-2,5-dioxopyrrol-1-yl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexanoic acid |
| SMILES | CC(C)(C)OC(=O)N(CCCCCC(=O)O)N1C(=O)C=C(Br)C1=O |
| InChI | InChI=1S/C15H21BrN2O6/c1-15(2,3)24-14(23)17(8-6-4-5-7-12(20)21)18-11(19)9-10(16)13(18)22/h9H,4-8H2,1-3H3,(H,20,21) |
| InChIKey | KZCJIJPCFYIJRU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|