C14H8I2N4 — CID 129188184
3,6-bis(2-iodophenyl)-1,2,4,5-tetrazine (PubChem CID 129188184) has the molecular formula C14H8I2N4 and a molecular weight of 486.05 g/mol. Its IUPAC name is 3,6-bis(2-iodophenyl)-1,2,4,5-tetrazine.
| Compound Name | 3,6-bis(2-iodophenyl)-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 129188184 |
| Molecular Formula | C14H8I2N4 |
| Molecular Weight | 486.05 g/mol |
| Exact Mass | 485.88 |
| IUPAC Name | 3,6-bis(2-iodophenyl)-1,2,4,5-tetrazine |
| SMILES | Ic1ccccc1-c1nnc(-c2ccccc2I)nn1 |
| InChI | InChI=1S/C14H8I2N4/c15-11-7-3-1-5-9(11)13-17-19-14(20-18-13)10-6-2-4-8-12(10)16/h1-8H |
| InChIKey | GROBRLCMEZANOQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.05 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|