C23H28NO2P — CID 129189827
1-[2-[2-(dimethylamino)-6-methoxyphenyl]phenyl]-2,2-dimethyl-6-methylidenephosphinan-4-one (PubChem CID 129189827) has the molecular formula C23H28NO2P and a molecular weight of 381.46 g/mol. Its IUPAC name is 1-[2-[2-(dimethylamino)-6-methoxyphenyl]phenyl]-2,2-dimethyl-6-methylidenephosphinan-4-one.
| Compound Name | 1-[2-[2-(dimethylamino)-6-methoxyphenyl]phenyl]-2,2-dimethyl-6-methylidenephosphinan-4-one |
|---|---|
| PubChem CID | 129189827 |
| Molecular Formula | C23H28NO2P |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 1-[2-[2-(dimethylamino)-6-methoxyphenyl]phenyl]-2,2-dimethyl-6-methylidenephosphinan-4-one |
| SMILES | C=C1CC(=O)CC(C)(C)P1c1ccccc1-c1c(OC)cccc1N(C)C |
| InChI | InChI=1S/C23H28NO2P/c1-16-14-17(25)15-23(2,3)27(16)21-13-8-7-10-18(21)22-19(24(4)5)11-9-12-20(22)26-6/h7-13H,1,14-15H2,2-6H3 |
| InChIKey | SPIDZRGUVVSGLJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|