C29H59NO2 — CID 129191677
(4-hexyl-2-methyldecan-3-yl) N-(2,4-dimethylpentan-2-yl)-N-(2-methylpropyl)carbamate (PubChem CID 129191677) has the molecular formula C29H59NO2 and a molecular weight of 453.80 g/mol. Its IUPAC name is (4-hexyl-2-methyldecan-3-yl) N-(2,4-dimethylpentan-2-yl)-N-(2-methylpropyl)carbamate.
| Compound Name | (4-hexyl-2-methyldecan-3-yl) N-(2,4-dimethylpentan-2-yl)-N-(2-methylpropyl)carbamate |
|---|---|
| PubChem CID | 129191677 |
| Molecular Formula | C29H59NO2 |
| Molecular Weight | 453.80 g/mol |
| Exact Mass | 453.45 |
| IUPAC Name | (4-hexyl-2-methyldecan-3-yl) N-(2,4-dimethylpentan-2-yl)-N-(2-methylpropyl)carbamate |
| SMILES | CCCCCCC(CCCCCC)C(OC(=O)N(CC(C)C)C(C)(C)CC(C)C)C(C)C |
| InChI | InChI=1S/C29H59NO2/c1-11-13-15-17-19-26(20-18-16-14-12-2)27(25(7)8)32-28(31)30(22-24(5)6)29(9,10)21-23(3)4/h23-27H,11-22H2,1-10H3 |
| InChIKey | LPVDNOIOJXNVHX-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.80 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|