C13H23F2N3O — CID 129196425
(2Z,5Z)-3-(difluoromethoxy)-N',2,4,5-tetramethyl-N-(methylamino)hepta-2,5-dienimidamide (PubChem CID 129196425) has the molecular formula C13H23F2N3O and a molecular weight of 275.34 g/mol. Its IUPAC name is (2Z,5Z)-3-(difluoromethoxy)-N',2,4,5-tetramethyl-N-(methylamino)hepta-2,5-dienimidamide.
| Compound Name | (2Z,5Z)-3-(difluoromethoxy)-N',2,4,5-tetramethyl-N-(methylamino)hepta-2,5-dienimidamide |
|---|---|
| PubChem CID | 129196425 |
| Molecular Formula | C13H23F2N3O |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.18 |
| IUPAC Name | (2Z,5Z)-3-(difluoromethoxy)-N',2,4,5-tetramethyl-N-(methylamino)hepta-2,5-dienimidamide |
| SMILES | C/C=C(/C)C(C)/C(OC(F)F)=C(C)/C(=N/C)NNC |
| InChI | InChI=1S/C13H23F2N3O/c1-7-8(2)9(3)11(19-13(14)15)10(4)12(16-5)18-17-6/h7,9,13,17H,1-6H3,(H,16,18)/b8-7-,11-10- |
| InChIKey | QCSQNLAUPRZDBL-NQLNTKRDSA-N |
| XLogP | 2.85 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|