C36H41N3O — CID 129203723
N-[1-(3-ethylphenyl)ethenyl]-3-[3-[N-methyl-C-[(1Z)-3-methylbuta-1,3-dienyl]carbonimidoyl]phenyl]-N'-[2-methyl-5-(2-oxopropyl)phenyl]propanimidamide (PubChem CID 129203723) has the molecular formula C36H41N3O and a molecular weight of 531.74 g/mol. Its IUPAC name is N-[1-(3-ethylphenyl)ethenyl]-3-[3-[N-methyl-C-[(1Z)-3-methylbuta-1,3-dienyl]carbonimidoyl]phenyl]-N'-[2-methyl-5-(2-oxopropyl)phenyl]propanimidamide.
| Compound Name | N-[1-(3-ethylphenyl)ethenyl]-3-[3-[N-methyl-C-[(1Z)-3-methylbuta-1,3-dienyl]carbonimidoyl]phenyl]-N'-[2-methyl-5-(2-oxopropyl)phenyl]propanimidamide |
|---|---|
| PubChem CID | 129203723 |
| Molecular Formula | C36H41N3O |
| Molecular Weight | 531.74 g/mol |
| Exact Mass | 531.32 |
| IUPAC Name | N-[1-(3-ethylphenyl)ethenyl]-3-[3-[N-methyl-C-[(1Z)-3-methylbuta-1,3-dienyl]carbonimidoyl]phenyl]-N'-[2-methyl-5-(2-oxopropyl)phenyl]propanimidamide |
| SMILES | C=C(C)/C=C\C(=N\C)c1cccc(CC/C(=N\c2cc(CC(C)=O)ccc2C)NC(=C)c2cccc(CC)c2)c1 |
| InChI | InChI=1S/C36H41N3O/c1-8-29-11-9-13-32(22-29)28(6)38-36(39-35-24-31(21-27(5)40)17-16-26(35)4)20-18-30-12-10-14-33(23-30)34(37-7)19-15-25(2)3/h9-17,19,22-24H,2,6,8,18,20-21H2,1,3-5,7H3,(H,38,39)/b19-15-,37-34- |
| InChIKey | YUSSCFOKVIJGTD-YYRWAFITSA-N |
| XLogP | 8.16 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.74 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|