C34H36FN3O2 — CID 123733000
N-[3-(2-amino-5-fluoro-4-methylphenyl)but-3-enyl]-3-[2-[[1-(3-ethylphenyl)-4-oxopent-2-enylidene]amino]prop-2-enyl]benzamide (PubChem CID 123733000) has the molecular formula C34H36FN3O2 and a molecular weight of 537.68 g/mol. Its IUPAC name is N-[3-(2-amino-5-fluoro-4-methylphenyl)but-3-enyl]-3-[2-[[1-(3-ethylphenyl)-4-oxopent-2-enylidene]amino]prop-2-enyl]benzamide.
| Compound Name | N-[3-(2-amino-5-fluoro-4-methylphenyl)but-3-enyl]-3-[2-[[1-(3-ethylphenyl)-4-oxopent-2-enylidene]amino]prop-2-enyl]benzamide |
|---|---|
| PubChem CID | 123733000 |
| Molecular Formula | C34H36FN3O2 |
| Molecular Weight | 537.68 g/mol |
| Exact Mass | 537.28 |
| IUPAC Name | N-[3-(2-amino-5-fluoro-4-methylphenyl)but-3-enyl]-3-[2-[[1-(3-ethylphenyl)-4-oxopent-2-enylidene]amino]prop-2-enyl]benzamide |
| SMILES | C=C(Cc1cccc(C(=O)NCCC(=C)c2cc(F)c(C)cc2N)c1)/N=C(\C=CC(C)=O)c1cccc(CC)c1 |
| InChI | InChI=1S/C34H36FN3O2/c1-6-26-9-7-11-28(19-26)33(14-13-25(5)39)38-24(4)18-27-10-8-12-29(20-27)34(40)37-16-15-22(2)30-21-31(35)23(3)17-32(30)36/h7-14,17,19-21H,2,4,6,15-16,18,36H2,1,3,5H3,(H,37,40)/b14-13?,38-33+ |
| InChIKey | XPDOMRRUGPVTCG-OGKKQJDCSA-N |
| XLogP | 6.80 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.68 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|