About [5-(pyrrolo[2,3-c]pyridin-1-ylmethyl)thiophen-3-yl]carbamoylcarbamic acid
[5-(pyrrolo[2,3-c]pyridin-1-ylmethyl)thiophen-3-yl]carbamoylcarbamic acid (PubChem CID 129204289) has the molecular formula C14H12N4O3S
and a molecular weight of 316.34 g/mol. Its IUPAC name is [5-(pyrrolo[2,3-c]pyridin-1-ylmethyl)thiophen-3-yl]carbamoylcarbamic acid.
Molecular Properties
| Compound Name | [5-(pyrrolo[2,3-c]pyridin-1-ylmethyl)thiophen-3-yl]carbamoylcarbamic acid |
| PubChem CID | 129204289 |
| Molecular Formula | C14H12N4O3S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | [5-(pyrrolo[2,3-c]pyridin-1-ylmethyl)thiophen-3-yl]carbamoylcarbamic acid |
| SMILES | O=C(O)NC(=O)Nc1csc(Cn2ccc3ccncc32)c1 |
| InChI | InChI=1S/C14H12N4O3S/c19-13(17-14(20)21)16-10-5-11(22-8-10)7-18-4-2-9-1-3-15-6-12(9)18/h1-6,8H,7H2,(H,20,21)(H2,16,17,19) |
| InChIKey | FSKPSVXIWCLAGP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-(pyrrolo[2,3-c]pyridin-1-ylmethyl)thiophen-3-yl]carbamoylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(pyrrolo[2,3-c]pyridin-1-ylmethyl)thiophen-3-yl]carbamoylcarbamic acid?
The IUPAC name of [5-(pyrrolo[2,3-c]pyridin-1-ylmethyl)thiophen-3-yl]carbamoylcarbamic acid (CID 129204289) is [5-(pyrrolo[2,3-c]pyridin-1-ylmethyl)thiophen-3-yl]carbamoylcarbamic acid.
What is the SMILES notation for [5-(pyrrolo[2,3-c]pyridin-1-ylmethyl)thiophen-3-yl]carbamoylcarbamic acid?
The canonical SMILES for [5-(pyrrolo[2,3-c]pyridin-1-ylmethyl)thiophen-3-yl]carbamoylcarbamic acid is O=C(O)NC(=O)Nc1csc(Cn2ccc3ccncc32)c1.
What is the InChIKey of [5-(pyrrolo[2,3-c]pyridin-1-ylmethyl)thiophen-3-yl]carbamoylcarbamic acid?
The InChIKey is FSKPSVXIWCLAGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4O3S/c19-13(17-14(20)21)16-10-5-11(22-8-10)7-18-4-2-9-1-3-15-6-12(9)18/h1-6,8H,7H2,(H,20,21)(H2,16,17,19).
What are the key properties of [5-(pyrrolo[2,3-c]pyridin-1-ylmethyl)thiophen-3-yl]carbamoylcarbamic acid?
[5-(pyrrolo[2,3-c]pyridin-1-ylmethyl)thiophen-3-yl]carbamoylcarbamic acid has a molecular weight of 316.34 g/mol, XLogP of 2.95, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(pyrrolo[2,3-c]pyridin-1-ylmethyl)thiophen-3-yl]carbamoylcarbamic acid is sourced from PubChem (CID 129204289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).