C14H26F2N2O2 — CID 129204676
tert-butyl 3-amino-5-(2,3-difluoropiperidin-1-yl)pentanoate (PubChem CID 129204676) has the molecular formula C14H26F2N2O2 and a molecular weight of 292.37 g/mol. Its IUPAC name is tert-butyl 3-amino-5-(2,3-difluoropiperidin-1-yl)pentanoate.
| Compound Name | tert-butyl 3-amino-5-(2,3-difluoropiperidin-1-yl)pentanoate |
|---|---|
| PubChem CID | 129204676 |
| Molecular Formula | C14H26F2N2O2 |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | tert-butyl 3-amino-5-(2,3-difluoropiperidin-1-yl)pentanoate |
| SMILES | CC(C)(C)OC(=O)CC(N)CCN1CCCC(F)C1F |
| InChI | InChI=1S/C14H26F2N2O2/c1-14(2,3)20-12(19)9-10(17)6-8-18-7-4-5-11(15)13(18)16/h10-11,13H,4-9,17H2,1-3H3 |
| InChIKey | MDJMGEJKKOZXJV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|