C27H29N5O6 — CID 129205972
tert-butyl 2,4-dioxo-1-(1-phenylmethoxycarbonylindazol-5-yl)-1,3,8-triazaspiro[4.5]decane-8-carboxylate (PubChem CID 129205972) has the molecular formula C27H29N5O6 and a molecular weight of 519.56 g/mol. Its IUPAC name is tert-butyl 2,4-dioxo-1-(1-phenylmethoxycarbonylindazol-5-yl)-1,3,8-triazaspiro[4.5]decane-8-carboxylate.
| Compound Name | tert-butyl 2,4-dioxo-1-(1-phenylmethoxycarbonylindazol-5-yl)-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 129205972 |
| Molecular Formula | C27H29N5O6 |
| Molecular Weight | 519.56 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | tert-butyl 2,4-dioxo-1-(1-phenylmethoxycarbonylindazol-5-yl)-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)C(=O)NC(=O)N2c1ccc2c(cnn2C(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C27H29N5O6/c1-26(2,3)38-24(35)30-13-11-27(12-14-30)22(33)29-23(34)31(27)20-9-10-21-19(15-20)16-28-32(21)25(36)37-17-18-7-5-4-6-8-18/h4-10,15-16H,11-14,17H2,1-3H3,(H,29,33,34) |
| InChIKey | OVPSYZROZKRIFN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 123.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.56 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|