C21H22BrN3O3 — CID 129206030
3-bromo-N-[3-(2-ethylpyrazol-3-yl)-4-(2-methoxyethoxy)phenyl]benzamide (PubChem CID 129206030) has the molecular formula C21H22BrN3O3 and a molecular weight of 444.33 g/mol. Its IUPAC name is 3-bromo-N-[3-(2-ethylpyrazol-3-yl)-4-(2-methoxyethoxy)phenyl]benzamide.
| Compound Name | 3-bromo-N-[3-(2-ethylpyrazol-3-yl)-4-(2-methoxyethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 129206030 |
| Molecular Formula | C21H22BrN3O3 |
| Molecular Weight | 444.33 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 3-bromo-N-[3-(2-ethylpyrazol-3-yl)-4-(2-methoxyethoxy)phenyl]benzamide |
| SMILES | CCn1nccc1-c1cc(NC(=O)c2cccc(Br)c2)ccc1OCCOC |
| InChI | InChI=1S/C21H22BrN3O3/c1-3-25-19(9-10-23-25)18-14-17(7-8-20(18)28-12-11-27-2)24-21(26)15-5-4-6-16(22)13-15/h4-10,13-14H,3,11-12H2,1-2H3,(H,24,26) |
| InChIKey | WKQKSTKJYLLMRL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.33 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|