C58H24F2N8 — CID 129206135
(3E,5E)-3,5-bis[cyano-(3,5-dicyanophenyl)methylidene]-4,8-bis(4-fluorophenyl)-2,6-diphenyl-s-indacene-1,7-dicarbonitrile (PubChem CID 129206135) has the molecular formula C58H24F2N8 and a molecular weight of 870.88 g/mol. Its IUPAC name is (3E,5E)-3,5-bis[cyano-(3,5-dicyanophenyl)methylidene]-4,8-bis(4-fluorophenyl)-2,6-diphenyl-s-indacene-1,7-dicarbonitrile.
| Compound Name | (3E,5E)-3,5-bis[cyano-(3,5-dicyanophenyl)methylidene]-4,8-bis(4-fluorophenyl)-2,6-diphenyl-s-indacene-1,7-dicarbonitrile |
|---|---|
| PubChem CID | 129206135 |
| Molecular Formula | C58H24F2N8 |
| Molecular Weight | 870.88 g/mol |
| Exact Mass | 870.21 |
| IUPAC Name | (3E,5E)-3,5-bis[cyano-(3,5-dicyanophenyl)methylidene]-4,8-bis(4-fluorophenyl)-2,6-diphenyl-s-indacene-1,7-dicarbonitrile |
| SMILES | N#CC1=C(c2ccccc2)/C(=C(/C#N)c2cc(C#N)cc(C#N)c2)c2c1c(-c1ccc(F)cc1)c1c(c2-c2ccc(F)cc2)/C(=C(\C#N)c2cc(C#N)cc(C#N)c2)C(c2ccccc2)=C1C#N |
| InChI | InChI=1S/C58H24F2N8/c59-43-15-11-39(12-16-43)51-55-47(31-67)49(37-7-3-1-4-8-37)53(45(29-65)41-21-33(25-61)19-34(22-41)26-62)57(55)52(40-13-17-44(60)18-14-40)58-54(46(30-66)42-23-35(27-63)20-36(24-42)28-64)50(48(32-68)56(51)58)38-9-5-2-6-10-38/h1-24H/b53-45+,54-46+ |
| InChIKey | WYDWCOIMBXHZEG-RBRUIUAASA-N |
| XLogP | 12.55 |
| TPSA | 190.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.88 |
| LogP ≤ 5 | 12.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|