C9H13F4N — CID 129207762
1-(1,1,1,3-tetrafluorobut-3-en-2-yl)piperidine (PubChem CID 129207762) has the molecular formula C9H13F4N and a molecular weight of 211.20 g/mol. Its IUPAC name is 1-(1,1,1,3-tetrafluorobut-3-en-2-yl)piperidine.
| Compound Name | 1-(1,1,1,3-tetrafluorobut-3-en-2-yl)piperidine |
|---|---|
| PubChem CID | 129207762 |
| Molecular Formula | C9H13F4N |
| Molecular Weight | 211.20 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 1-(1,1,1,3-tetrafluorobut-3-en-2-yl)piperidine |
| SMILES | C=C(F)C(N1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C9H13F4N/c1-7(10)8(9(11,12)13)14-5-3-2-4-6-14/h8H,1-6H2 |
| InChIKey | BYSIIXJRSVLIKW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.20 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |