C17H11F3N2O3 — CID 129218352
2,3-dioxo-1-[[2-(trifluoromethyl)phenyl]methyl]indole-5-carboxamide (PubChem CID 129218352) has the molecular formula C17H11F3N2O3 and a molecular weight of 348.28 g/mol. Its IUPAC name is 2,3-dioxo-1-[[2-(trifluoromethyl)phenyl]methyl]indole-5-carboxamide.
| Compound Name | 2,3-dioxo-1-[[2-(trifluoromethyl)phenyl]methyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 129218352 |
| Molecular Formula | C17H11F3N2O3 |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 2,3-dioxo-1-[[2-(trifluoromethyl)phenyl]methyl]indole-5-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H11F3N2O3/c18-17(19,20)12-4-2-1-3-10(12)8-22-13-6-5-9(15(21)24)7-11(13)14(23)16(22)25/h1-7H,8H2,(H2,21,24) |
| InChIKey | QOCASMYUWMSZPS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|