C26H20F3NO3 — CID 162587958
4-[(Z)-[(4S)-4-methyl-2-oxo-1-[[2-(trifluoromethyl)phenyl]methyl]-4H-quinolin-3-ylidene]methyl]benzoic acid (PubChem CID 162587958) has the molecular formula C26H20F3NO3 and a molecular weight of 451.44 g/mol. Its IUPAC name is 4-[(Z)-[(4S)-4-methyl-2-oxo-1-[[2-(trifluoromethyl)phenyl]methyl]-4H-quinolin-3-ylidene]methyl]benzoic acid.
| Compound Name | 4-[(Z)-[(4S)-4-methyl-2-oxo-1-[[2-(trifluoromethyl)phenyl]methyl]-4H-quinolin-3-ylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 162587958 |
| Molecular Formula | C26H20F3NO3 |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 4-[(Z)-[(4S)-4-methyl-2-oxo-1-[[2-(trifluoromethyl)phenyl]methyl]-4H-quinolin-3-ylidene]methyl]benzoic acid |
| SMILES | C[C@@H]1/C(=C/c2ccc(C(=O)O)cc2)C(=O)N(Cc2ccccc2C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C26H20F3NO3/c1-16-20-7-3-5-9-23(20)30(15-19-6-2-4-8-22(19)26(27,28)29)24(31)21(16)14-17-10-12-18(13-11-17)25(32)33/h2-14,16H,15H2,1H3,(H,32,33)/b21-14-/t16-/m0/s1 |
| InChIKey | MJNWEUFVUJHNFK-AKGOGDBKSA-N |
| XLogP | 6.14 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|