C14H12F3NO5 — CID 129218566
ethyl 2-[2,3-dioxo-5-(trifluoromethoxy)indol-1-yl]propanoate (PubChem CID 129218566) has the molecular formula C14H12F3NO5 and a molecular weight of 331.25 g/mol. Its IUPAC name is ethyl 2-[2,3-dioxo-5-(trifluoromethoxy)indol-1-yl]propanoate.
| Compound Name | ethyl 2-[2,3-dioxo-5-(trifluoromethoxy)indol-1-yl]propanoate |
|---|---|
| PubChem CID | 129218566 |
| Molecular Formula | C14H12F3NO5 |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | ethyl 2-[2,3-dioxo-5-(trifluoromethoxy)indol-1-yl]propanoate |
| SMILES | CCOC(=O)C(C)N1C(=O)C(=O)c2cc(OC(F)(F)F)ccc21 |
| InChI | InChI=1S/C14H12F3NO5/c1-3-22-13(21)7(2)18-10-5-4-8(23-14(15,16)17)6-9(10)11(19)12(18)20/h4-7H,3H2,1-2H3 |
| InChIKey | DDNUARLNHMYEHL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|