C18H18F3NO8 — CID 166714411
1-[1-[3-[1-(3-methoxyoxiran-2-yl)oxyethoxy]oxiran-2-yl]ethyl]-5-(trifluoromethoxy)indole-2,3-dione (PubChem CID 166714411) has the molecular formula C18H18F3NO8 and a molecular weight of 433.34 g/mol. Its IUPAC name is 1-[1-[3-[1-(3-methoxyoxiran-2-yl)oxyethoxy]oxiran-2-yl]ethyl]-5-(trifluoromethoxy)indole-2,3-dione.
| Compound Name | 1-[1-[3-[1-(3-methoxyoxiran-2-yl)oxyethoxy]oxiran-2-yl]ethyl]-5-(trifluoromethoxy)indole-2,3-dione |
|---|---|
| PubChem CID | 166714411 |
| Molecular Formula | C18H18F3NO8 |
| Molecular Weight | 433.34 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 1-[1-[3-[1-(3-methoxyoxiran-2-yl)oxyethoxy]oxiran-2-yl]ethyl]-5-(trifluoromethoxy)indole-2,3-dione |
| SMILES | COC1OC1OC(C)OC1OC1C(C)N1C(=O)C(=O)c2cc(OC(F)(F)F)ccc21 |
| InChI | InChI=1S/C18H18F3NO8/c1-7(13-15(28-13)26-8(2)27-17-16(25-3)29-17)22-11-5-4-9(30-18(19,20)21)6-10(11)12(23)14(22)24/h4-8,13,15-17H,1-3H3 |
| InChIKey | BPGQNZPBBREUPE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 99.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|