C14H14F3NO7 — CID 156828436
1-[2-hydroxy-2-(1-hydroxyethoxymethoxy)ethyl]-5-(trifluoromethoxy)indole-2,3-dione (PubChem CID 156828436) has the molecular formula C14H14F3NO7 and a molecular weight of 365.26 g/mol. Its IUPAC name is 1-[2-hydroxy-2-(1-hydroxyethoxymethoxy)ethyl]-5-(trifluoromethoxy)indole-2,3-dione.
| Compound Name | 1-[2-hydroxy-2-(1-hydroxyethoxymethoxy)ethyl]-5-(trifluoromethoxy)indole-2,3-dione |
|---|---|
| PubChem CID | 156828436 |
| Molecular Formula | C14H14F3NO7 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 1-[2-hydroxy-2-(1-hydroxyethoxymethoxy)ethyl]-5-(trifluoromethoxy)indole-2,3-dione |
| SMILES | CC(O)OCOC(O)CN1C(=O)C(=O)c2cc(OC(F)(F)F)ccc21 |
| InChI | InChI=1S/C14H14F3NO7/c1-7(19)23-6-24-11(20)5-18-10-3-2-8(25-14(15,16)17)4-9(10)12(21)13(18)22/h2-4,7,11,19-20H,5-6H2,1H3 |
| InChIKey | SUWKKMAQWYJPRV-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|