C21H32N6OS — CID 129221261
[3-[(Z)-1-amino-3-iminoprop-1-en-2-yl]phenyl] [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl]sulfanylmethanimidate (PubChem CID 129221261) has the molecular formula C21H32N6OS and a molecular weight of 416.60 g/mol. Its IUPAC name is [3-[(Z)-1-amino-3-iminoprop-1-en-2-yl]phenyl] [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl]sulfanylmethanimidate.
| Compound Name | [3-[(Z)-1-amino-3-iminoprop-1-en-2-yl]phenyl] [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl]sulfanylmethanimidate |
|---|---|
| PubChem CID | 129221261 |
| Molecular Formula | C21H32N6OS |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | [3-[(Z)-1-amino-3-iminoprop-1-en-2-yl]phenyl] [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl]sulfanylmethanimidate |
| SMILES | [H]/N=C(\S/C(=N/[H])Oc1cccc(C(=C/N)/C=N/[H])c1)N(C)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C21H32N6OS/c1-20(2)10-16(11-21(3,4)26-20)27(5)18(24)29-19(25)28-17-8-6-7-14(9-17)15(12-22)13-23/h6-9,12-13,16,22,24-26H,10-11,23H2,1-5H3/b15-13+,22-12+,24-18-,25-19+ |
| InChIKey | KBJXMIRZLZGXQN-HUXABPGOSA-N |
| XLogP | 3.86 |
| TPSA | 122.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|