C21H20FN3O5S — CID 129225792
[(3S)-pyrrolidin-3-yl]methylsulfonyl 2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoate (PubChem CID 129225792) has the molecular formula C21H20FN3O5S and a molecular weight of 445.47 g/mol. Its IUPAC name is [(3S)-pyrrolidin-3-yl]methylsulfonyl 2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoate.
| Compound Name | [(3S)-pyrrolidin-3-yl]methylsulfonyl 2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 129225792 |
| Molecular Formula | C21H20FN3O5S |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | [(3S)-pyrrolidin-3-yl]methylsulfonyl 2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoate |
| SMILES | O=C(OS(=O)(=O)C[C@H]1CCNC1)c1cc(Cc2n[nH]c(=O)c3ccccc23)ccc1F |
| InChI | InChI=1S/C21H20FN3O5S/c22-18-6-5-13(10-19-15-3-1-2-4-16(15)20(26)25-24-19)9-17(18)21(27)30-31(28,29)12-14-7-8-23-11-14/h1-6,9,14,23H,7-8,10-12H2,(H,25,26)/t14-/m0/s1 |
| InChIKey | LCRNCMKTAFVWNV-AWEZNQCLSA-N |
| XLogP | 1.75 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|