C20H35N3O — CID 12923164
2-[2-[di(propan-2-yl)amino]ethyl]-5-methyl-2-pyridin-2-ylhexanamide (PubChem CID 12923164) has the molecular formula C20H35N3O and a molecular weight of 333.52 g/mol. Its IUPAC name is 2-[2-[di(propan-2-yl)amino]ethyl]-5-methyl-2-pyridin-2-ylhexanamide.
| Compound Name | 2-[2-[di(propan-2-yl)amino]ethyl]-5-methyl-2-pyridin-2-ylhexanamide |
|---|---|
| PubChem CID | 12923164 |
| Molecular Formula | C20H35N3O |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.28 |
| IUPAC Name | 2-[2-[di(propan-2-yl)amino]ethyl]-5-methyl-2-pyridin-2-ylhexanamide |
| SMILES | CC(C)CCC(CCN(C(C)C)C(C)C)(C(N)=O)c1ccccn1 |
| InChI | InChI=1S/C20H35N3O/c1-15(2)10-11-20(19(21)24,18-9-7-8-13-22-18)12-14-23(16(3)4)17(5)6/h7-9,13,15-17H,10-12,14H2,1-6H3,(H2,21,24) |
| InChIKey | FUIWPZRNLDWDRB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |