C24H36N4O — CID 23277066
4-[di(propan-2-yl)amino]-N,N',N'-trimethyl-2-phenyl-2-pyridin-2-ylbutanehydrazide (PubChem CID 23277066) has the molecular formula C24H36N4O and a molecular weight of 396.58 g/mol. Its IUPAC name is 4-[di(propan-2-yl)amino]-N,N',N'-trimethyl-2-phenyl-2-pyridin-2-ylbutanehydrazide.
| Compound Name | 4-[di(propan-2-yl)amino]-N,N',N'-trimethyl-2-phenyl-2-pyridin-2-ylbutanehydrazide |
|---|---|
| PubChem CID | 23277066 |
| Molecular Formula | C24H36N4O |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | 4-[di(propan-2-yl)amino]-N,N',N'-trimethyl-2-phenyl-2-pyridin-2-ylbutanehydrazide |
| SMILES | CC(C)N(CCC(C(=O)N(C)N(C)C)(c1ccccc1)c1ccccn1)C(C)C |
| InChI | InChI=1S/C24H36N4O/c1-19(2)28(20(3)4)18-16-24(21-13-9-8-10-14-21,22-15-11-12-17-25-22)23(29)27(7)26(5)6/h8-15,17,19-20H,16,18H2,1-7H3 |
| InChIKey | CMWDRBTULYKJAK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|