C21H26ClI2N3O — CID 70413984
4-[bis(1-iodopropan-2-yl)amino]-2-(2-chlorophenyl)-2-pyridin-2-ylbutanamide (PubChem CID 70413984) has the molecular formula C21H26ClI2N3O and a molecular weight of 625.72 g/mol. Its IUPAC name is 4-[bis(1-iodopropan-2-yl)amino]-2-(2-chlorophenyl)-2-pyridin-2-ylbutanamide.
| Compound Name | 4-[bis(1-iodopropan-2-yl)amino]-2-(2-chlorophenyl)-2-pyridin-2-ylbutanamide |
|---|---|
| PubChem CID | 70413984 |
| Molecular Formula | C21H26ClI2N3O |
| Molecular Weight | 625.72 g/mol |
| Exact Mass | 624.99 |
| IUPAC Name | 4-[bis(1-iodopropan-2-yl)amino]-2-(2-chlorophenyl)-2-pyridin-2-ylbutanamide |
| SMILES | CC(CI)N(CCC(C(N)=O)(c1ccccn1)c1ccccc1Cl)C(C)CI |
| InChI | InChI=1S/C21H26ClI2N3O/c1-15(13-23)27(16(2)14-24)12-10-21(20(25)28,19-9-5-6-11-26-19)17-7-3-4-8-18(17)22/h3-9,11,15-16H,10,12-14H2,1-2H3,(H2,25,28) |
| InChIKey | OGFCIMCQCGOROB-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.72 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|