C24H25F3N2O2 — CID 129231805
(3-methylcyclohexyl) (2R)-2-[2-[4-(trifluoromethyl)phenyl]benzimidazol-1-yl]propanoate (PubChem CID 129231805) has the molecular formula C24H25F3N2O2 and a molecular weight of 430.47 g/mol. Its IUPAC name is (3-methylcyclohexyl) (2R)-2-[2-[4-(trifluoromethyl)phenyl]benzimidazol-1-yl]propanoate.
| Compound Name | (3-methylcyclohexyl) (2R)-2-[2-[4-(trifluoromethyl)phenyl]benzimidazol-1-yl]propanoate |
|---|---|
| PubChem CID | 129231805 |
| Molecular Formula | C24H25F3N2O2 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | (3-methylcyclohexyl) (2R)-2-[2-[4-(trifluoromethyl)phenyl]benzimidazol-1-yl]propanoate |
| SMILES | CC1CCCC(OC(=O)[C@@H](C)n2c(-c3ccc(C(F)(F)F)cc3)nc3ccccc32)C1 |
| InChI | InChI=1S/C24H25F3N2O2/c1-15-6-5-7-19(14-15)31-23(30)16(2)29-21-9-4-3-8-20(21)28-22(29)17-10-12-18(13-11-17)24(25,26)27/h3-4,8-13,15-16,19H,5-7,14H2,1-2H3/t15?,16-,19?/m1/s1 |
| InChIKey | DUNOVJHQHDKTFB-KOHRHEQBSA-N |
| XLogP | 6.41 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |