C31H36N6O2S — CID 129233872
N-[(1R,2S)-2-(buta-1,3-dien-2-ylamino)cyclohexyl]-7-(6-cyclopentyloxy-4-methyl-3-pyridinyl)-6-methylidene-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 129233872) has the molecular formula C31H36N6O2S and a molecular weight of 556.74 g/mol. Its IUPAC name is N-[(1R,2S)-2-(buta-1,3-dien-2-ylamino)cyclohexyl]-7-(6-cyclopentyloxy-4-methyl-3-pyridinyl)-6-methylidene-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | N-[(1R,2S)-2-(buta-1,3-dien-2-ylamino)cyclohexyl]-7-(6-cyclopentyloxy-4-methyl-3-pyridinyl)-6-methylidene-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 129233872 |
| Molecular Formula | C31H36N6O2S |
| Molecular Weight | 556.74 g/mol |
| Exact Mass | 556.26 |
| IUPAC Name | N-[(1R,2S)-2-(buta-1,3-dien-2-ylamino)cyclohexyl]-7-(6-cyclopentyloxy-4-methyl-3-pyridinyl)-6-methylidene-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | C=CC(=C)N[C@H]1CCCC[C@H]1NC(=O)c1sc2nccc3c2c1[nH]c(=C)n3-c1cnc(OC2CCCC2)cc1C |
| InChI | InChI=1S/C31H36N6O2S/c1-5-19(3)34-22-12-8-9-13-23(22)36-30(38)29-28-27-24(14-15-32-31(27)40-29)37(20(4)35-28)25-17-33-26(16-18(25)2)39-21-10-6-7-11-21/h5,14-17,21-23,34-35H,1,3-4,6-13H2,2H3,(H,36,38)/t22-,23+/m0/s1 |
| InChIKey | IWDSMQLHZMVRFN-XZOQPEGZSA-N |
| XLogP | 5.61 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.74 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|