C15H15F3O — CID 129241382
1-[3-[(Z)-pent-2-enoxy]prop-1-ynyl]-4-(trifluoromethyl)benzene (PubChem CID 129241382) has the molecular formula C15H15F3O and a molecular weight of 268.28 g/mol. Its IUPAC name is 1-[3-[(Z)-pent-2-enoxy]prop-1-ynyl]-4-(trifluoromethyl)benzene.
| Compound Name | 1-[3-[(Z)-pent-2-enoxy]prop-1-ynyl]-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 129241382 |
| Molecular Formula | C15H15F3O |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 1-[3-[(Z)-pent-2-enoxy]prop-1-ynyl]-4-(trifluoromethyl)benzene |
| SMILES | CC/C=C\COCC#Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H15F3O/c1-2-3-4-11-19-12-5-6-13-7-9-14(10-8-13)15(16,17)18/h3-4,7-10H,2,11-12H2,1H3/b4-3- |
| InChIKey | KIVONUDETASTNR-ARJAWSKDSA-N |
| XLogP | 4.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|