C26H23ClF5N7O3S — CID 129243026
3-[2-[(5S)-4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-1,3-thiazol-4-yl]-2,2-dimethylpropanoic acid (PubChem CID 129243026) has the molecular formula C26H23ClF5N7O3S and a molecular weight of 644.03 g/mol. Its IUPAC name is 3-[2-[(5S)-4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-1,3-thiazol-4-yl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[2-[(5S)-4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-1,3-thiazol-4-yl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 129243026 |
| Molecular Formula | C26H23ClF5N7O3S |
| Molecular Weight | 644.03 g/mol |
| Exact Mass | 643.12 |
| IUPAC Name | 3-[2-[(5S)-4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-1,3-thiazol-4-yl]-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(Cc1csc([C@]2(C)C(=O)Nc3nc(-c4nn(CCC(F)(F)C(F)(F)F)c5cc(Cl)ccc45)nc(N)c32)n1)C(=O)O |
| InChI | InChI=1S/C26H23ClF5N7O3S/c1-23(2,22(41)42)9-12-10-43-21(34-12)24(3)15-17(33)35-19(36-18(15)37-20(24)40)16-13-5-4-11(27)8-14(13)39(38-16)7-6-25(28,29)26(30,31)32/h4-5,8,10H,6-7,9H2,1-3H3,(H,41,42)(H3,33,35,36,37,40)/t24-/m0/s1 |
| InChIKey | OPLRFRGVNNUYML-DEOSSOPVSA-N |
| XLogP | 5.68 |
| TPSA | 148.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.03 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|