C24H20ClF5N8O5 — CID 140793104
ethyl 2-[5-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-2-oxo-1,3,4-oxadiazol-3-yl]acetate (PubChem CID 140793104) has the molecular formula C24H20ClF5N8O5 and a molecular weight of 630.92 g/mol. Its IUPAC name is ethyl 2-[5-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-2-oxo-1,3,4-oxadiazol-3-yl]acetate.
| Compound Name | ethyl 2-[5-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-2-oxo-1,3,4-oxadiazol-3-yl]acetate |
|---|---|
| PubChem CID | 140793104 |
| Molecular Formula | C24H20ClF5N8O5 |
| Molecular Weight | 630.92 g/mol |
| Exact Mass | 630.12 |
| IUPAC Name | ethyl 2-[5-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-2-oxo-1,3,4-oxadiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1nc(C2(C)C(=O)Nc3nc(-c4nn(CCC(F)(F)C(F)(F)F)c5cc(Cl)ccc45)nc(N)c32)oc1=O |
| InChI | InChI=1S/C24H20ClF5N8O5/c1-3-42-13(39)9-38-21(41)43-20(36-38)22(2)14-16(31)32-18(33-17(14)34-19(22)40)15-11-5-4-10(25)8-12(11)37(35-15)7-6-23(26,27)24(28,29)30/h4-5,8H,3,6-7,9H2,1-2H3,(H3,31,32,33,34,40) |
| InChIKey | VRTXHMFGRUBMSN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 173.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.92 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|