C27H21ClF5N7O3 — CID 129242806
methyl 3-[6-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-3-pyridinyl]prop-2-enoate (PubChem CID 129242806) has the molecular formula C27H21ClF5N7O3 and a molecular weight of 621.95 g/mol. Its IUPAC name is methyl 3-[6-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-3-pyridinyl]prop-2-enoate.
| Compound Name | methyl 3-[6-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-3-pyridinyl]prop-2-enoate |
|---|---|
| PubChem CID | 129242806 |
| Molecular Formula | C27H21ClF5N7O3 |
| Molecular Weight | 621.95 g/mol |
| Exact Mass | 621.13 |
| IUPAC Name | methyl 3-[6-[4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-3-pyridinyl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1ccc(C2(C)C(=O)Nc3nc(-c4nn(CCC(F)(F)C(F)(F)F)c5cc(Cl)ccc45)nc(N)c32)nc1 |
| InChI | InChI=1S/C27H21ClF5N7O3/c1-25(17-7-3-13(12-35-17)4-8-18(41)43-2)19-21(34)36-23(37-22(19)38-24(25)42)20-15-6-5-14(28)11-16(15)40(39-20)10-9-26(29,30)27(31,32)33/h3-8,11-12H,9-10H2,1-2H3,(H3,34,36,37,38,42) |
| InChIKey | UEEZXWJOJOQTPU-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 137.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.95 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|