C20H16ClF3N8O2 — CID 89438326
4-amino-2-[6-chloro-1-(3,3,3-trifluoropropyl)indazol-3-yl]-5-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 89438326) has the molecular formula C20H16ClF3N8O2 and a molecular weight of 492.85 g/mol. Its IUPAC name is 4-amino-2-[6-chloro-1-(3,3,3-trifluoropropyl)indazol-3-yl]-5-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-2-[6-chloro-1-(3,3,3-trifluoropropyl)indazol-3-yl]-5-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 89438326 |
| Molecular Formula | C20H16ClF3N8O2 |
| Molecular Weight | 492.85 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | 4-amino-2-[6-chloro-1-(3,3,3-trifluoropropyl)indazol-3-yl]-5-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | Cc1noc(C2(C)C(=O)Nc3nc(-c4nn(CCC(F)(F)F)c5cc(Cl)ccc45)nc(N)c32)n1 |
| InChI | InChI=1S/C20H16ClF3N8O2/c1-8-26-18(34-31-8)19(2)12-14(25)27-16(28-15(12)29-17(19)33)13-10-4-3-9(21)7-11(10)32(30-13)6-5-20(22,23)24/h3-4,7H,5-6H2,1-2H3,(H3,25,27,28,29,33) |
| InChIKey | HELOZHXHUSHNSB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 137.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.85 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |