C16H13ClO3 — CID 12925058
4-[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]benzaldehyde (PubChem CID 12925058) has the molecular formula C16H13ClO3 and a molecular weight of 288.73 g/mol. Its IUPAC name is 4-[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]benzaldehyde.
| Compound Name | 4-[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]benzaldehyde |
|---|---|
| PubChem CID | 12925058 |
| Molecular Formula | C16H13ClO3 |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 4-[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]benzaldehyde |
| SMILES | O=Cc1ccc(C2(c3ccc(Cl)cc3)OCCO2)cc1 |
| InChI | InChI=1S/C16H13ClO3/c17-15-7-5-14(6-8-15)16(19-9-10-20-16)13-3-1-12(11-18)2-4-13/h1-8,11H,9-10H2 |
| InChIKey | XJMKQMQPUYACLT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|