C16H30N4O2S — CID 129253107
N-(4-aminocyclohexyl)-5-[(2S,4R)-4-(carbamoylamino)thiolan-2-yl]pentanamide (PubChem CID 129253107) has the molecular formula C16H30N4O2S and a molecular weight of 342.51 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-5-[(2S,4R)-4-(carbamoylamino)thiolan-2-yl]pentanamide.
| Compound Name | N-(4-aminocyclohexyl)-5-[(2S,4R)-4-(carbamoylamino)thiolan-2-yl]pentanamide |
|---|---|
| PubChem CID | 129253107 |
| Molecular Formula | C16H30N4O2S |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | N-(4-aminocyclohexyl)-5-[(2S,4R)-4-(carbamoylamino)thiolan-2-yl]pentanamide |
| SMILES | NC(=O)N[C@H]1CS[C@@H](CCCCC(=O)NC2CCC(N)CC2)C1 |
| InChI | InChI=1S/C16H30N4O2S/c17-11-5-7-12(8-6-11)19-15(21)4-2-1-3-14-9-13(10-23-14)20-16(18)22/h11-14H,1-10,17H2,(H,19,21)(H3,18,20,22)/t11?,12?,13-,14+/m1/s1 |
| InChIKey | GHJLXHJPENRBAQ-PQAZSJQKSA-N |
| XLogP | 1.48 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|