C12H22N6O2S — CID 173496908
N-(2-azidoethyl)-5-[(2S,4R)-4-(carbamoylamino)thiolan-2-yl]pentanamide (PubChem CID 173496908) has the molecular formula C12H22N6O2S and a molecular weight of 314.42 g/mol. Its IUPAC name is N-(2-azidoethyl)-5-[(2S,4R)-4-(carbamoylamino)thiolan-2-yl]pentanamide.
| Compound Name | N-(2-azidoethyl)-5-[(2S,4R)-4-(carbamoylamino)thiolan-2-yl]pentanamide |
|---|---|
| PubChem CID | 173496908 |
| Molecular Formula | C12H22N6O2S |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | N-(2-azidoethyl)-5-[(2S,4R)-4-(carbamoylamino)thiolan-2-yl]pentanamide |
| SMILES | [N-]=[N+]=NCCNC(=O)CCCC[C@H]1C[C@@H](NC(N)=O)CS1 |
| InChI | InChI=1S/C12H22N6O2S/c13-12(20)17-9-7-10(21-8-9)3-1-2-4-11(19)15-5-6-16-18-14/h9-10H,1-8H2,(H,15,19)(H3,13,17,20)/t9-,10+/m1/s1 |
| InChIKey | OZRGDZGXNWWOBL-ZJUUUORDSA-N |
| XLogP | 1.52 |
| TPSA | 132.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|