C20H36N2O3S — CID 129027493
5-[(4R)-4-formamidothiolan-2-yl]-N-[3-methyl-3-(3-methylbut-3-enoxy)butyl]pentanamide (PubChem CID 129027493) has the molecular formula C20H36N2O3S and a molecular weight of 384.59 g/mol. Its IUPAC name is 5-[(4R)-4-formamidothiolan-2-yl]-N-[3-methyl-3-(3-methylbut-3-enoxy)butyl]pentanamide.
| Compound Name | 5-[(4R)-4-formamidothiolan-2-yl]-N-[3-methyl-3-(3-methylbut-3-enoxy)butyl]pentanamide |
|---|---|
| PubChem CID | 129027493 |
| Molecular Formula | C20H36N2O3S |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 5-[(4R)-4-formamidothiolan-2-yl]-N-[3-methyl-3-(3-methylbut-3-enoxy)butyl]pentanamide |
| SMILES | C=C(C)CCOC(C)(C)CCNC(=O)CCCCC1C[C@@H](NC=O)CS1 |
| InChI | InChI=1S/C20H36N2O3S/c1-16(2)9-12-25-20(3,4)10-11-21-19(24)8-6-5-7-18-13-17(14-26-18)22-15-23/h15,17-18H,1,5-14H2,2-4H3,(H,21,24)(H,22,23)/t17-,18?/m1/s1 |
| InChIKey | WIOAPSJDCHHIKH-QNSVNVJESA-N |
| XLogP | 3.43 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|