C22H43N5O4S — CID 90446767
5-[5-[(2R,4R)-4-(methylcarbamoylamino)thiolan-2-yl]pentanoylamino]pentyl 6-hydrazinylhexanoate (PubChem CID 90446767) has the molecular formula C22H43N5O4S and a molecular weight of 473.68 g/mol. Its IUPAC name is 5-[5-[(2R,4R)-4-(methylcarbamoylamino)thiolan-2-yl]pentanoylamino]pentyl 6-hydrazinylhexanoate.
| Compound Name | 5-[5-[(2R,4R)-4-(methylcarbamoylamino)thiolan-2-yl]pentanoylamino]pentyl 6-hydrazinylhexanoate |
|---|---|
| PubChem CID | 90446767 |
| Molecular Formula | C22H43N5O4S |
| Molecular Weight | 473.68 g/mol |
| Exact Mass | 473.30 |
| IUPAC Name | 5-[5-[(2R,4R)-4-(methylcarbamoylamino)thiolan-2-yl]pentanoylamino]pentyl 6-hydrazinylhexanoate |
| SMILES | CNC(=O)N[C@H]1CS[C@H](CCCCC(=O)NCCCCCOC(=O)CCCCCNN)C1 |
| InChI | InChI=1S/C22H43N5O4S/c1-24-22(30)27-18-16-19(32-17-18)10-5-6-11-20(28)25-13-7-3-9-15-31-21(29)12-4-2-8-14-26-23/h18-19,26H,2-17,23H2,1H3,(H,25,28)(H2,24,27,30)/t18-,19-/m1/s1 |
| InChIKey | OGCNEOGMBIADOI-RTBURBONSA-N |
| XLogP | 2.20 |
| TPSA | 134.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.68 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|