C19H42N2OS — CID 144831522
ethane;N-[(3R,4S)-4-(methylamino)-2-(5-methylhex-5-enyl)thiolan-3-yl]formamide (PubChem CID 144831522) has the molecular formula C19H42N2OS and a molecular weight of 346.63 g/mol. Its IUPAC name is ethane;N-[(3R,4S)-4-(methylamino)-2-(5-methylhex-5-enyl)thiolan-3-yl]formamide.
| Compound Name | ethane;N-[(3R,4S)-4-(methylamino)-2-(5-methylhex-5-enyl)thiolan-3-yl]formamide |
|---|---|
| PubChem CID | 144831522 |
| Molecular Formula | C19H42N2OS |
| Molecular Weight | 346.63 g/mol |
| Exact Mass | 346.30 |
| IUPAC Name | ethane;N-[(3R,4S)-4-(methylamino)-2-(5-methylhex-5-enyl)thiolan-3-yl]formamide |
| SMILES | C=C(C)CCCCC1SC[C@@H](NC)[C@H]1NC=O.CC.CC.CC |
| InChI | InChI=1S/C13H24N2OS.3C2H6/c1-10(2)6-4-5-7-12-13(15-9-16)11(14-3)8-17-12;3*1-2/h9,11-14H,1,4-8H2,2-3H3,(H,15,16);3*1-2H3/t11-,12?,13-;;;/m1.../s1 |
| InChIKey | FRSRRVIGNJXWSK-RAQZMADXSA-N |
| XLogP | 5.02 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.63 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|