C25H47N3O4S — CID 155747024
3-[2-[5-[2-[6-[4-(ethenylamino)-3-(methylamino)thiolan-2-yl]hex-1-en-2-ylamino]ethoxy]pentoxy]ethoxy]propanal (PubChem CID 155747024) has the molecular formula C25H47N3O4S and a molecular weight of 485.74 g/mol. Its IUPAC name is 3-[2-[5-[2-[6-[4-(ethenylamino)-3-(methylamino)thiolan-2-yl]hex-1-en-2-ylamino]ethoxy]pentoxy]ethoxy]propanal.
| Compound Name | 3-[2-[5-[2-[6-[4-(ethenylamino)-3-(methylamino)thiolan-2-yl]hex-1-en-2-ylamino]ethoxy]pentoxy]ethoxy]propanal |
|---|---|
| PubChem CID | 155747024 |
| Molecular Formula | C25H47N3O4S |
| Molecular Weight | 485.74 g/mol |
| Exact Mass | 485.33 |
| IUPAC Name | 3-[2-[5-[2-[6-[4-(ethenylamino)-3-(methylamino)thiolan-2-yl]hex-1-en-2-ylamino]ethoxy]pentoxy]ethoxy]propanal |
| SMILES | C=CNC1CSC(CCCCC(=C)NCCOCCCCCOCCOCCC=O)C1NC |
| InChI | InChI=1S/C25H47N3O4S/c1-4-27-23-21-33-24(25(23)26-3)12-7-6-11-22(2)28-13-18-30-15-8-5-9-16-31-19-20-32-17-10-14-29/h4,14,23-28H,1-2,5-13,15-21H2,3H3 |
| InChIKey | YUYIXVRSIRLQMY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.74 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|